N-[2-(6-chloro-1H-indol-1-yl)ethyl]-2-(1H-indol-3-yl)acetamide
Chemical Structure Depiction of
N-[2-(6-chloro-1H-indol-1-yl)ethyl]-2-(1H-indol-3-yl)acetamide
N-[2-(6-chloro-1H-indol-1-yl)ethyl]-2-(1H-indol-3-yl)acetamide
Compound characteristics
| Compound ID: | Y041-5948 |
| Compound Name: | N-[2-(6-chloro-1H-indol-1-yl)ethyl]-2-(1H-indol-3-yl)acetamide |
| Molecular Weight: | 351.83 |
| Molecular Formula: | C20 H18 Cl N3 O |
| Smiles: | C(C(NCCn1ccc2ccc(cc12)[Cl])=O)c1c[nH]c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 3.8829 |
| logD: | 3.8829 |
| logSw: | -4.3533 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 36.24 |
| InChI Key: | XQRODJWIHOBBGX-UHFFFAOYSA-N |