5-(3-fluorophenyl)-2-methyl-N-(pyridin-2-yl)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
5-(3-fluorophenyl)-2-methyl-N-(pyridin-2-yl)-1,3-thiazole-4-carboxamide
5-(3-fluorophenyl)-2-methyl-N-(pyridin-2-yl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | Y041-8720 |
| Compound Name: | 5-(3-fluorophenyl)-2-methyl-N-(pyridin-2-yl)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 313.35 |
| Molecular Formula: | C16 H12 F N3 O S |
| Smiles: | Cc1nc(C(Nc2ccccn2)=O)c(c2cccc(c2)F)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.053 |
| logD: | 4.0529 |
| logSw: | -4.1093 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.255 |
| InChI Key: | PGLWRVAVKQDWMM-UHFFFAOYSA-N |