N-(2-hydroxyphenyl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-(2-hydroxyphenyl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide
N-(2-hydroxyphenyl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | Y041-8806 |
| Compound Name: | N-(2-hydroxyphenyl)-2-methyl-5-phenyl-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 310.37 |
| Molecular Formula: | C17 H14 N2 O2 S |
| Smiles: | Cc1nc(C(Nc2ccccc2O)=O)c(c2ccccc2)s1 |
| Stereo: | ACHIRAL |
| logP: | 4.0821 |
| logD: | 4.0769 |
| logSw: | -3.6819 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 49.491 |
| InChI Key: | NUALHNJOERGZOS-UHFFFAOYSA-N |