N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-bromo-5-(propan-2-yl)-1,3-thiazole-4-carboxamide
					Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-bromo-5-(propan-2-yl)-1,3-thiazole-4-carboxamide
			N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-bromo-5-(propan-2-yl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | Y041-8859 | 
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-2-bromo-5-(propan-2-yl)-1,3-thiazole-4-carboxamide | 
| Molecular Weight: | 383.26 | 
| Molecular Formula: | C15 H15 Br N2 O3 S | 
| Smiles: | CC(C)c1c(C(NCc2ccc3c(c2)OCO3)=O)nc(s1)[Br] | 
| Stereo: | ACHIRAL | 
| logP: | 3.9036 | 
| logD: | 3.9036 | 
| logSw: | -3.9671 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 52.893 | 
| InChI Key: | MQERFVUJRUHWKE-UHFFFAOYSA-N | 
 
				 
				