N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-5-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxamide
Chemical Structure Depiction of
N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-5-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxamide
N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-5-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxamide
Compound characteristics
| Compound ID: | Y042-2563 |
| Compound Name: | N-(5,6-dimethoxy-2,3-dihydro-1H-inden-1-yl)-5-methyl-2-(1H-pyrrol-1-yl)-1,3-thiazole-4-carboxamide |
| Molecular Weight: | 383.47 |
| Molecular Formula: | C20 H21 N3 O3 S |
| Smiles: | Cc1c(C(NC2CCc3cc(c(cc23)OC)OC)=O)nc(n2cccc2)s1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5399 |
| logD: | 3.5399 |
| logSw: | -3.7822 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.699 |
| InChI Key: | CSFDJLGRKMSVGG-HNNXBMFYSA-N |