methyl 2-amino-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate
Chemical Structure Depiction of
methyl 2-amino-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate
methyl 2-amino-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate
Compound characteristics
| Compound ID: | Y042-3027 |
| Compound Name: | methyl 2-amino-5-(2-methylpropyl)-1,3-thiazole-4-carboxylate |
| Molecular Weight: | 214.28 |
| Molecular Formula: | C9 H14 N2 O2 S |
| Smiles: | CC(C)Cc1c(C(=O)OC)nc(N)s1 |
| Stereo: | ACHIRAL |
| logP: | 2.3719 |
| logD: | 2.3719 |
| logSw: | -2.3555 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.986 |
| InChI Key: | ITSRZQHYKKOAEW-UHFFFAOYSA-N |