N-{5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl}-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide
Chemical Structure Depiction of
N-{5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl}-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide
N-{5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl}-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide
Compound characteristics
| Compound ID: | Y042-4340 |
| Compound Name: | N-{5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl}-1-(2-methoxyphenyl)-5-oxopyrrolidine-3-carboxamide |
| Molecular Weight: | 426.47 |
| Molecular Formula: | C21 H19 F N4 O3 S |
| Smiles: | COc1ccccc1N1CC(CC1=O)C(Nc1nnc(Cc2ccc(cc2)F)s1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8884 |
| logD: | 2.6658 |
| logSw: | -3.3932 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.178 |
| InChI Key: | ZWTHAZCAMPMQEC-AWEZNQCLSA-N |