methyl N-{4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl}-L-phenylalaninate
Chemical Structure Depiction of
methyl N-{4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl}-L-phenylalaninate
methyl N-{4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl}-L-phenylalaninate
Compound characteristics
| Compound ID: | Y042-8066 |
| Compound Name: | methyl N-{4-[bis(4-fluorophenyl)methyl]piperazine-1-carbonyl}-L-phenylalaninate |
| Molecular Weight: | 493.55 |
| Molecular Formula: | C28 H29 F2 N3 O3 |
| Smiles: | COC([C@H](Cc1ccccc1)NC(N1CCN(CC1)C(c1ccc(cc1)F)c1ccc(cc1)F)=O)=O |
| Stereo: | ABSOLUTE |
| logP: | 4.6662 |
| logD: | 4.6498 |
| logSw: | -4.3213 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 50.395 |
| InChI Key: | UHDAASJMMFQMAG-VWLOTQADSA-N |