N-[3-(1H-indol-1-yl)propanoyl]-L-leucine
Chemical Structure Depiction of
N-[3-(1H-indol-1-yl)propanoyl]-L-leucine
N-[3-(1H-indol-1-yl)propanoyl]-L-leucine
Compound characteristics
| Compound ID: | Y043-0908 |
| Compound Name: | N-[3-(1H-indol-1-yl)propanoyl]-L-leucine |
| Molecular Weight: | 302.37 |
| Molecular Formula: | C17 H22 N2 O3 |
| Smiles: | CC(C)C[C@@H](C(O)=O)NC(CCn1ccc2ccccc12)=O |
| Stereo: | ABSOLUTE |
| logP: | 2.0446 |
| logD: | -1.5733 |
| logSw: | -2.357 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.837 |
| InChI Key: | ROABMWZHSDROKN-AWEZNQCLSA-N |