[1-({2-[3-(3-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexyl]acetic acid
Chemical Structure Depiction of
[1-({2-[3-(3-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexyl]acetic acid
[1-({2-[3-(3-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexyl]acetic acid
Compound characteristics
| Compound ID: | Y043-1237 |
| Compound Name: | [1-({2-[3-(3-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexyl]acetic acid |
| Molecular Weight: | 413.47 |
| Molecular Formula: | C22 H27 N3 O5 |
| Smiles: | COc1cccc(c1)C1C=CC(N(CC(NCC2(CCCCC2)CC(O)=O)=O)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8463 |
| logD: | -0.9131 |
| logSw: | -2.2613 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 89.139 |
| InChI Key: | YNLHFSAXAHHUMH-UHFFFAOYSA-N |