4-({2-[3-(4-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexane-1-carboxylic acid
					Chemical Structure Depiction of
4-({2-[3-(4-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexane-1-carboxylic acid
			4-({2-[3-(4-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexane-1-carboxylic acid
Compound characteristics
| Compound ID: | Y043-1254 | 
| Compound Name: | 4-({2-[3-(4-methoxyphenyl)-6-oxopyridazin-1(6H)-yl]acetamido}methyl)cyclohexane-1-carboxylic acid | 
| Molecular Weight: | 399.45 | 
| Molecular Formula: | C21 H25 N3 O5 | 
| Smiles: | COc1ccc(cc1)C1C=CC(N(CC(NC[C@@H]2CC[C@H](CC2)C(O)=O)=O)N=1)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.6609 | 
| logD: | -0.8994 | 
| logSw: | -2.1968 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 89.163 | 
| InChI Key: | MGWNCCJRERCJQI-UHFFFAOYSA-N | 
 
				 
				