N-{[3-(4-bromophenyl)-6-oxopyridazin-1(6H)-yl]acetyl}-L-phenylalanine
Chemical Structure Depiction of
N-{[3-(4-bromophenyl)-6-oxopyridazin-1(6H)-yl]acetyl}-L-phenylalanine
N-{[3-(4-bromophenyl)-6-oxopyridazin-1(6H)-yl]acetyl}-L-phenylalanine
Compound characteristics
| Compound ID: | Y043-1863 |
| Compound Name: | N-{[3-(4-bromophenyl)-6-oxopyridazin-1(6H)-yl]acetyl}-L-phenylalanine |
| Molecular Weight: | 456.29 |
| Molecular Formula: | C21 H18 Br N3 O4 |
| Smiles: | C(c1ccccc1)[C@@H](C(O)=O)NC(CN1C(C=CC(c2ccc(cc2)[Br])=N1)=O)=O |
| Stereo: | ABSOLUTE |
| logP: | 2.1543 |
| logD: | -1.4783 |
| logSw: | -2.661 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 81.058 |
| InChI Key: | UAYDOLPZJUNNAO-SFHVURJKSA-N |