6-(3,4-dimethoxyphenyl)-2-{[4-(methanesulfonyl)piperazin-1-yl]methyl}pyridazin-3(2H)-one
Chemical Structure Depiction of
6-(3,4-dimethoxyphenyl)-2-{[4-(methanesulfonyl)piperazin-1-yl]methyl}pyridazin-3(2H)-one
6-(3,4-dimethoxyphenyl)-2-{[4-(methanesulfonyl)piperazin-1-yl]methyl}pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | Y043-2850 |
| Compound Name: | 6-(3,4-dimethoxyphenyl)-2-{[4-(methanesulfonyl)piperazin-1-yl]methyl}pyridazin-3(2H)-one |
| Molecular Weight: | 408.47 |
| Molecular Formula: | C18 H24 N4 O5 S |
| Smiles: | COc1ccc(cc1OC)C1C=CC(N(CN2CCN(CC2)S(C)(=O)=O)N=1)=O |
| Stereo: | ACHIRAL |
| logP: | 0.6926 |
| logD: | 0.6925 |
| logSw: | -2.1859 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 80.517 |
| InChI Key: | GEQZTKCQBXDMAD-UHFFFAOYSA-N |