5-[(3S)-1,2-dithiolan-3-yl]-N-[2-(4-methoxyphenyl)-2-oxoethyl]pentanamide
Chemical Structure Depiction of
5-[(3S)-1,2-dithiolan-3-yl]-N-[2-(4-methoxyphenyl)-2-oxoethyl]pentanamide
5-[(3S)-1,2-dithiolan-3-yl]-N-[2-(4-methoxyphenyl)-2-oxoethyl]pentanamide
Compound characteristics
| Compound ID: | Y043-3453 |
| Compound Name: | 5-[(3S)-1,2-dithiolan-3-yl]-N-[2-(4-methoxyphenyl)-2-oxoethyl]pentanamide |
| Molecular Weight: | 353.5 |
| Molecular Formula: | C17 H23 N O3 S2 |
| Smiles: | COc1ccc(cc1)C(CNC(CCCC[C@H]1CCSS1)=O)=O |
| Stereo: | ABSOLUTE |
| logP: | 3.0277 |
| logD: | 3.0277 |
| logSw: | -3.4849 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 45.787 |
| InChI Key: | TYYLUAWCFFFION-HNNXBMFYSA-N |