N-[2-(furan-2-yl)ethyl]-2-[5-(4-methoxyphenyl)-3-methyl-1H-pyrazol-4-yl]acetamide
Chemical Structure Depiction of
N-[2-(furan-2-yl)ethyl]-2-[5-(4-methoxyphenyl)-3-methyl-1H-pyrazol-4-yl]acetamide
N-[2-(furan-2-yl)ethyl]-2-[5-(4-methoxyphenyl)-3-methyl-1H-pyrazol-4-yl]acetamide
Compound characteristics
| Compound ID: | Y043-4391 |
| Compound Name: | N-[2-(furan-2-yl)ethyl]-2-[5-(4-methoxyphenyl)-3-methyl-1H-pyrazol-4-yl]acetamide |
| Molecular Weight: | 339.39 |
| Molecular Formula: | C19 H21 N3 O3 |
| Smiles: | Cc1c(CC(NCCc2ccco2)=O)c(c2ccc(cc2)OC)[nH]n1 |
| Stereo: | ACHIRAL |
| logP: | 2.4791 |
| logD: | 2.479 |
| logSw: | -2.601 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.41 |
| InChI Key: | QSCBOAKZTCARGX-UHFFFAOYSA-N |