methyl 5-(2-methoxyphenyl)-2-[2-(2,4,5-trifluorophenyl)acetamido]-1,3-thiazole-4-carboxylate
Chemical Structure Depiction of
methyl 5-(2-methoxyphenyl)-2-[2-(2,4,5-trifluorophenyl)acetamido]-1,3-thiazole-4-carboxylate
methyl 5-(2-methoxyphenyl)-2-[2-(2,4,5-trifluorophenyl)acetamido]-1,3-thiazole-4-carboxylate
Compound characteristics
| Compound ID: | Y043-4805 |
| Compound Name: | methyl 5-(2-methoxyphenyl)-2-[2-(2,4,5-trifluorophenyl)acetamido]-1,3-thiazole-4-carboxylate |
| Molecular Weight: | 436.41 |
| Molecular Formula: | C20 H15 F3 N2 O4 S |
| Smiles: | COC(c1c(c2ccccc2OC)sc(NC(Cc2cc(c(cc2F)F)F)=O)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.4764 |
| logD: | 4.4761 |
| logSw: | -4.4981 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.466 |
| InChI Key: | YVQAHOHHFUHQIK-UHFFFAOYSA-N |