N-(2-{[(6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl]sulfanyl}ethyl)-1-methyl-1H-indole-4-carboxamide
Chemical Structure Depiction of
N-(2-{[(6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl]sulfanyl}ethyl)-1-methyl-1H-indole-4-carboxamide
N-(2-{[(6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl]sulfanyl}ethyl)-1-methyl-1H-indole-4-carboxamide
Compound characteristics
| Compound ID: | Y043-4917 |
| Compound Name: | N-(2-{[(6,7-dimethoxy-4-oxo-3,4-dihydroquinazolin-2-yl)methyl]sulfanyl}ethyl)-1-methyl-1H-indole-4-carboxamide |
| Molecular Weight: | 452.53 |
| Molecular Formula: | C23 H24 N4 O4 S |
| Smiles: | Cn1ccc2c(cccc12)C(NCCSCC1NC(c2cc(c(cc2N=1)OC)OC)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3772 |
| logD: | 2.3769 |
| logSw: | -3.0744 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.354 |
| InChI Key: | CWGVCPGIQIPHNI-UHFFFAOYSA-N |