N-(1-methyl-1H-indol-5-yl)-2-[4-(1H-pyrrol-1-yl)oxan-4-yl]acetamide
Chemical Structure Depiction of
N-(1-methyl-1H-indol-5-yl)-2-[4-(1H-pyrrol-1-yl)oxan-4-yl]acetamide
N-(1-methyl-1H-indol-5-yl)-2-[4-(1H-pyrrol-1-yl)oxan-4-yl]acetamide
Compound characteristics
| Compound ID: | Y043-5616 |
| Compound Name: | N-(1-methyl-1H-indol-5-yl)-2-[4-(1H-pyrrol-1-yl)oxan-4-yl]acetamide |
| Molecular Weight: | 337.42 |
| Molecular Formula: | C20 H23 N3 O2 |
| Smiles: | Cn1ccc2cc(ccc12)NC(CC1(CCOCC1)n1cccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0984 |
| logD: | 3.0984 |
| logSw: | -3.2881 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.458 |
| InChI Key: | XGZQWKFJPMTABY-UHFFFAOYSA-N |