3-hydroxy-4-methyl-2-[(methyl{[rel-(1R,9aS)-octahydro-2H-quinolizin-1-yl]methyl}amino)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Chemical Structure Depiction of
3-hydroxy-4-methyl-2-[(methyl{[rel-(1R,9aS)-octahydro-2H-quinolizin-1-yl]methyl}amino)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
3-hydroxy-4-methyl-2-[(methyl{[rel-(1R,9aS)-octahydro-2H-quinolizin-1-yl]methyl}amino)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one
Compound characteristics
| Compound ID: | Y043-6283 |
| Compound Name: | 3-hydroxy-4-methyl-2-[(methyl{[rel-(1R,9aS)-octahydro-2H-quinolizin-1-yl]methyl}amino)methyl]-7,8,9,10-tetrahydro-6H-dibenzo[b,d]pyran-6-one |
| Molecular Weight: | 424.58 |
| Molecular Formula: | C26 H36 N2 O3 |
| Smiles: | Cc1c(c(CN(C)C[C@@H]2CCCN3CCCC[C@H]23)cc2C3CCCCC=3C(=O)Oc12)O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 4.2706 |
| logD: | 2.7383 |
| logSw: | -4.1108 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.439 |
| InChI Key: | GIUNMUSJRWBYGC-JPYJTQIMSA-N |