4-(1,2-benzothiazol-3-yl)-N-{2-[(1-methyl-1H-pyrazol-4-yl)amino]-2-oxoethyl}piperazine-1-carboxamide
Chemical Structure Depiction of
4-(1,2-benzothiazol-3-yl)-N-{2-[(1-methyl-1H-pyrazol-4-yl)amino]-2-oxoethyl}piperazine-1-carboxamide
4-(1,2-benzothiazol-3-yl)-N-{2-[(1-methyl-1H-pyrazol-4-yl)amino]-2-oxoethyl}piperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y043-6602 |
| Compound Name: | 4-(1,2-benzothiazol-3-yl)-N-{2-[(1-methyl-1H-pyrazol-4-yl)amino]-2-oxoethyl}piperazine-1-carboxamide |
| Molecular Weight: | 399.47 |
| Molecular Formula: | C18 H21 N7 O2 S |
| Smiles: | Cn1cc(cn1)NC(CNC(N1CCN(CC1)c1c2ccccc2sn1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.7329 |
| logD: | 1.7322 |
| logSw: | -2.2598 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 78.401 |
| InChI Key: | SADZOCUGIHGXOC-UHFFFAOYSA-N |