N-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-4-phenylpiperazine-1-carboxamide
Chemical Structure Depiction of
N-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-4-phenylpiperazine-1-carboxamide
N-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-4-phenylpiperazine-1-carboxamide
Compound characteristics
| Compound ID: | Y043-6688 |
| Compound Name: | N-[2-oxo-2-(thiomorpholin-4-yl)ethyl]-4-phenylpiperazine-1-carboxamide |
| Molecular Weight: | 348.47 |
| Molecular Formula: | C17 H24 N4 O2 S |
| Smiles: | C(C(N1CCSCC1)=O)NC(N1CCN(CC1)c1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.0697 |
| logD: | 1.0659 |
| logSw: | -2.0873 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 46.682 |
| InChI Key: | BLBZESKPJODZNB-UHFFFAOYSA-N |