N-(3,5-dimethoxyphenyl)-N~2~-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)carbamoyl]glycinamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-N~2~-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)carbamoyl]glycinamide
N-(3,5-dimethoxyphenyl)-N~2~-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)carbamoyl]glycinamide
Compound characteristics
| Compound ID: | Y043-7361 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-N~2~-[(1,1-dioxo-1lambda~6~-thiolan-3-yl)carbamoyl]glycinamide |
| Molecular Weight: | 371.41 |
| Molecular Formula: | C15 H21 N3 O6 S |
| Smiles: | COc1cc(cc(c1)OC)NC(CNC(NC1CCS(C1)(=O)=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 0.1654 |
| logD: | 0.1653 |
| logSw: | -2.0219 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 101.585 |
| InChI Key: | STNAPWZBIDIELT-SNVBAGLBSA-N |