4-{[2-(2-methyl-1H-indol-1-yl)acetamido]methyl}cyclohexane-1-carboxylic acid
Chemical Structure Depiction of
4-{[2-(2-methyl-1H-indol-1-yl)acetamido]methyl}cyclohexane-1-carboxylic acid
4-{[2-(2-methyl-1H-indol-1-yl)acetamido]methyl}cyclohexane-1-carboxylic acid
Compound characteristics
| Compound ID: | Y044-1069 |
| Compound Name: | 4-{[2-(2-methyl-1H-indol-1-yl)acetamido]methyl}cyclohexane-1-carboxylic acid |
| Molecular Weight: | 328.41 |
| Molecular Formula: | C19 H24 N2 O3 |
| Smiles: | Cc1cc2ccccc2n1CC(NC[C@H]1CC[C@@H](CC1)C(O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.4506 |
| logD: | -0.1097 |
| logSw: | -2.8645 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 54.735 |
| InChI Key: | DPYKNIHAPRTQGC-UHFFFAOYSA-N |