N-[2-(4-methoxybenzene-1-sulfonyl)ethyl]-1-methyl-1H-indole-4-carboxamide
Chemical Structure Depiction of
N-[2-(4-methoxybenzene-1-sulfonyl)ethyl]-1-methyl-1H-indole-4-carboxamide
N-[2-(4-methoxybenzene-1-sulfonyl)ethyl]-1-methyl-1H-indole-4-carboxamide
Compound characteristics
| Compound ID: | Y044-3700 |
| Compound Name: | N-[2-(4-methoxybenzene-1-sulfonyl)ethyl]-1-methyl-1H-indole-4-carboxamide |
| Molecular Weight: | 372.44 |
| Molecular Formula: | C19 H20 N2 O4 S |
| Smiles: | Cn1ccc2c(cccc12)C(NCCS(c1ccc(cc1)OC)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2041 |
| logD: | 2.2041 |
| logSw: | -2.8754 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.74 |
| InChI Key: | RVWPYVFGCJEIGJ-UHFFFAOYSA-N |