N-(4-bromophenyl)-N~2~-ethyl-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Chemical Structure Depiction of
N-(4-bromophenyl)-N~2~-ethyl-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
N-(4-bromophenyl)-N~2~-ethyl-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide
Compound characteristics
| Compound ID: | Y050-0149 |
| Compound Name: | N-(4-bromophenyl)-N~2~-ethyl-N~2~-(4-methylbenzene-1-sulfonyl)glycinamide |
| Molecular Weight: | 411.32 |
| Molecular Formula: | C17 H19 Br N2 O3 S |
| Smiles: | CCN(CC(Nc1ccc(cc1)[Br])=O)S(c1ccc(C)cc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.193 |
| logD: | 4.192 |
| logSw: | -4.0782 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.488 |
| InChI Key: | WTMJACMOVVDMTE-UHFFFAOYSA-N |