N-[2-ethoxy-5-(4-methylpiperazine-1-sulfonyl)phenyl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[2-ethoxy-5-(4-methylpiperazine-1-sulfonyl)phenyl]-2-fluorobenzamide
N-[2-ethoxy-5-(4-methylpiperazine-1-sulfonyl)phenyl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | Y050-1340 |
| Compound Name: | N-[2-ethoxy-5-(4-methylpiperazine-1-sulfonyl)phenyl]-2-fluorobenzamide |
| Molecular Weight: | 421.49 |
| Molecular Formula: | C20 H24 F N3 O4 S |
| Smiles: | CCOc1ccc(cc1NC(c1ccccc1F)=O)S(N1CCN(C)CC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3532 |
| logD: | 1.8016 |
| logSw: | -3.1884 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.03 |
| InChI Key: | JGHDDMRYKWWQET-UHFFFAOYSA-N |