1-(5-chloro-2-methoxybenzene-1-sulfonyl)-N-[(oxolan-2-yl)methyl]piperidine-4-carboxamide
Chemical Structure Depiction of
1-(5-chloro-2-methoxybenzene-1-sulfonyl)-N-[(oxolan-2-yl)methyl]piperidine-4-carboxamide
1-(5-chloro-2-methoxybenzene-1-sulfonyl)-N-[(oxolan-2-yl)methyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | Y050-1618 |
| Compound Name: | 1-(5-chloro-2-methoxybenzene-1-sulfonyl)-N-[(oxolan-2-yl)methyl]piperidine-4-carboxamide |
| Molecular Weight: | 416.92 |
| Molecular Formula: | C18 H25 Cl N2 O5 S |
| Smiles: | COc1ccc(cc1S(N1CCC(CC1)C(NCC1CCCO1)=O)(=O)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5905 |
| logD: | 1.5905 |
| logSw: | -2.8554 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.647 |
| InChI Key: | HKPQBUMOGNEKDI-OAHLLOKOSA-N |