4-methoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide
Chemical Structure Depiction of
4-methoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide
4-methoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide
Compound characteristics
| Compound ID: | Y070-0083 |
| Compound Name: | 4-methoxy-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)benzamide |
| Molecular Weight: | 343.38 |
| Molecular Formula: | C21 H17 N3 O2 |
| Smiles: | COc1ccc(cc1)C(Nc1c(c2ccccc2)nc2ccccn12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.6081 |
| logD: | 3.6079 |
| logSw: | -3.7166 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.402 |
| InChI Key: | RZKMNFBXGFBGET-UHFFFAOYSA-N |