di(propan-2-yl) 4-[3-(furan-2-yl)-1-phenyl-1H-pyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Chemical Structure Depiction of
di(propan-2-yl) 4-[3-(furan-2-yl)-1-phenyl-1H-pyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
di(propan-2-yl) 4-[3-(furan-2-yl)-1-phenyl-1H-pyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate
Compound characteristics
| Compound ID: | Y070-0118 |
| Compound Name: | di(propan-2-yl) 4-[3-(furan-2-yl)-1-phenyl-1H-pyrazol-4-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Molecular Weight: | 489.57 |
| Molecular Formula: | C28 H31 N3 O5 |
| Smiles: | CC(C)OC(C1C(C(=C(C)NC=1C)C(=O)OC(C)C)c1cn(c2ccccc2)nc1c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.2714 |
| logD: | 1.2226 |
| logSw: | -5.1414 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.43 |
| InChI Key: | RWQLJMNLKDYGRC-UHFFFAOYSA-N |