N-benzyl-3,6-dichloro-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
N-benzyl-3,6-dichloro-1-benzothiophene-2-carboxamide
N-benzyl-3,6-dichloro-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y070-0166 |
| Compound Name: | N-benzyl-3,6-dichloro-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 336.24 |
| Molecular Formula: | C16 H11 Cl2 N O S |
| Smiles: | C(c1ccccc1)NC(c1c(c2ccc(cc2s1)[Cl])[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.2417 |
| logD: | 5.2417 |
| logSw: | -5.7142 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.3985 |
| InChI Key: | SFUIFKKKMQXYQS-UHFFFAOYSA-N |