(3-chloro-6-methyl-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone
Chemical Structure Depiction of
(3-chloro-6-methyl-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone
(3-chloro-6-methyl-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone
Compound characteristics
| Compound ID: | Y070-0421 |
| Compound Name: | (3-chloro-6-methyl-1-benzothiophen-2-yl)(2,6-dimethylmorpholin-4-yl)methanone |
| Molecular Weight: | 323.84 |
| Molecular Formula: | C16 H18 Cl N O2 S |
| Smiles: | CC1CN(CC(C)O1)C(c1c(c2ccc(C)cc2s1)[Cl])=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.9414 |
| logD: | 3.9414 |
| logSw: | -4.4682 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.5659 |
| InChI Key: | UZBQEWCSZKDTAC-UHFFFAOYSA-N |