5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2-[2-(thiophen-2-yl)ethenyl][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Chemical Structure Depiction of
5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2-[2-(thiophen-2-yl)ethenyl][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2-[2-(thiophen-2-yl)ethenyl][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one
Compound characteristics
| Compound ID: | Y070-2921 |
| Compound Name: | 5-[(4-ethoxy-3-methoxyphenyl)methylidene]-2-[2-(thiophen-2-yl)ethenyl][1,3]thiazolo[3,2-b][1,2,4]triazol-6(5H)-one |
| Molecular Weight: | 411.5 |
| Molecular Formula: | C20 H17 N3 O3 S2 |
| Smiles: | CCOc1ccc(/C=C2/C(n3c(nc(/C=C/c4cccs4)n3)S2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 3.615 |
| logD: | 3.615 |
| logSw: | -3.748 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 54.046 |
| InChI Key: | QSSYMKZJIIGNIL-UHFFFAOYSA-N |