N-[2-{2-[4-(2-amino-2-oxoethoxy)phenyl]-1-cyanoethenyl}-4-(thiophen-2-yl)-1,3-thiazol-5-yl]thiophene-2-carboxamide
Chemical Structure Depiction of
N-[2-{2-[4-(2-amino-2-oxoethoxy)phenyl]-1-cyanoethenyl}-4-(thiophen-2-yl)-1,3-thiazol-5-yl]thiophene-2-carboxamide
N-[2-{2-[4-(2-amino-2-oxoethoxy)phenyl]-1-cyanoethenyl}-4-(thiophen-2-yl)-1,3-thiazol-5-yl]thiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y070-3007 |
| Compound Name: | N-[2-{2-[4-(2-amino-2-oxoethoxy)phenyl]-1-cyanoethenyl}-4-(thiophen-2-yl)-1,3-thiazol-5-yl]thiophene-2-carboxamide |
| Molecular Weight: | 492.6 |
| Molecular Formula: | C23 H16 N4 O3 S3 |
| Smiles: | C(C(N)=O)Oc1ccc(\C=C(/C#N)c2nc(c3cccs3)c(NC(c3cccs3)=O)s2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.2294 |
| logD: | 4.2231 |
| logSw: | -4.4595 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 92.318 |
| InChI Key: | CYQUZEQGCOZVDL-UHFFFAOYSA-N |