4-chloro-N-{[4-(diethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)benzamide
Chemical Structure Depiction of
4-chloro-N-{[4-(diethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)benzamide
4-chloro-N-{[4-(diethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)benzamide
Compound characteristics
| Compound ID: | Y070-3836 |
| Compound Name: | 4-chloro-N-{[4-(diethylamino)phenyl]methyl}-N-(1,1-dioxo-1lambda~6~-thiolan-3-yl)benzamide |
| Molecular Weight: | 434.98 |
| Molecular Formula: | C22 H27 Cl N2 O3 S |
| Smiles: | CCN(CC)c1ccc(CN(C2CCS(C2)(=O)=O)C(c2ccc(cc2)[Cl])=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.3641 |
| logD: | 3.0595 |
| logSw: | -3.861 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 46.596 |
| InChI Key: | MNPRMNCHVZFDOR-NRFANRHFSA-N |