2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-hydroxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Chemical Structure Depiction of
2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-hydroxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-hydroxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione
Compound characteristics
| Compound ID: | Y070-3917 |
| Compound Name: | 2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-hydroxyphenyl)-6,7-dimethyl-1,2-dihydro[1]benzopyrano[2,3-c]pyrrole-3,9-dione |
| Molecular Weight: | 485.54 |
| Molecular Formula: | C29 H27 N O6 |
| Smiles: | Cc1cc2C(C3C(c4ccc(cc4)O)N(CCc4ccc(c(c4)OC)OC)C(C=3Oc2cc1C)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.7613 |
| logD: | 4.7601 |
| logSw: | -4.4667 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 69.589 |
| InChI Key: | DJULLFQZYKJQNM-AREMUKBSSA-N |