N-({1-[2-(3-methoxyphenoxy)ethyl]-1H-benzimidazol-2-yl}methyl)furan-2-carboxamide
Chemical Structure Depiction of
N-({1-[2-(3-methoxyphenoxy)ethyl]-1H-benzimidazol-2-yl}methyl)furan-2-carboxamide
N-({1-[2-(3-methoxyphenoxy)ethyl]-1H-benzimidazol-2-yl}methyl)furan-2-carboxamide
Compound characteristics
| Compound ID: | Y080-0290 |
| Compound Name: | N-({1-[2-(3-methoxyphenoxy)ethyl]-1H-benzimidazol-2-yl}methyl)furan-2-carboxamide |
| Molecular Weight: | 391.43 |
| Molecular Formula: | C22 H21 N3 O4 |
| Smiles: | COc1cccc(c1)OCCn1c2ccccc2nc1CNC(c1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7966 |
| logD: | 3.7965 |
| logSw: | -3.9797 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.075 |
| InChI Key: | HZRVGGIOEATKGM-UHFFFAOYSA-N |