4-{1-[(4-tert-butylphenyl)methyl]-1H-benzimidazol-2-yl}-1-methylpyrrolidin-2-one
Chemical Structure Depiction of
4-{1-[(4-tert-butylphenyl)methyl]-1H-benzimidazol-2-yl}-1-methylpyrrolidin-2-one
4-{1-[(4-tert-butylphenyl)methyl]-1H-benzimidazol-2-yl}-1-methylpyrrolidin-2-one
Compound characteristics
| Compound ID: | Y080-0472 |
| Compound Name: | 4-{1-[(4-tert-butylphenyl)methyl]-1H-benzimidazol-2-yl}-1-methylpyrrolidin-2-one |
| Molecular Weight: | 361.49 |
| Molecular Formula: | C23 H27 N3 O |
| Smiles: | CC(C)(C)c1ccc(Cn2c3ccccc3nc2C2CC(N(C)C2)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.6426 |
| logD: | 4.6418 |
| logSw: | -4.3909 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 27.0779 |
| InChI Key: | GBSWSYDKQMKANC-QGZVFWFLSA-N |