4-{1-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
Chemical Structure Depiction of
4-{1-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
4-{1-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | Y080-0510 |
| Compound Name: | 4-{1-[(2-chlorophenyl)methyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one |
| Molecular Weight: | 365.86 |
| Molecular Formula: | C21 H20 Cl N3 O |
| Smiles: | C=CCN1CC(CC1=O)c1nc2ccccc2n1Cc1ccccc1[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1535 |
| logD: | 4.1532 |
| logSw: | -4.2936 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 27.3411 |
| InChI Key: | SADPRRIEFPCQNX-INIZCTEOSA-N |