4-{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
Chemical Structure Depiction of
4-{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
4-{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | Y080-0519 |
| Compound Name: | 4-{1-[2-(2,4-dimethylphenoxy)ethyl]-1H-benzimidazol-2-yl}-1-(prop-2-en-1-yl)pyrrolidin-2-one |
| Molecular Weight: | 389.5 |
| Molecular Formula: | C24 H27 N3 O2 |
| Smiles: | Cc1ccc(c(C)c1)OCCn1c2ccccc2nc1C1CC(N(CC=C)C1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.835 |
| logD: | 4.835 |
| logSw: | -4.7214 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 34.824 |
| InChI Key: | YSJPSJAWFNACRO-LJQANCHMSA-N |