2-phenyl-N-[5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl]butanamide
Chemical Structure Depiction of
2-phenyl-N-[5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl]butanamide
2-phenyl-N-[5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl]butanamide
Compound characteristics
| Compound ID: | Y200-0149 |
| Compound Name: | 2-phenyl-N-[5-(pyridin-4-yl)-1,3,4-thiadiazol-2-yl]butanamide |
| Molecular Weight: | 324.4 |
| Molecular Formula: | C17 H16 N4 O S |
| Smiles: | CCC(C(Nc1nnc(c2ccncc2)s1)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5277 |
| logD: | 3.5239 |
| logSw: | -3.5755 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.031 |
| InChI Key: | AADQDOVXNOIIGA-CQSZACIVSA-N |