3-chloro-N-[1-(pyridin-4-yl)ethyl]-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-[1-(pyridin-4-yl)ethyl]-1-benzothiophene-2-carboxamide
3-chloro-N-[1-(pyridin-4-yl)ethyl]-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y200-0176 |
| Compound Name: | 3-chloro-N-[1-(pyridin-4-yl)ethyl]-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 316.81 |
| Molecular Formula: | C16 H13 Cl N2 O S |
| Smiles: | CC(c1ccncc1)NC(c1c(c2ccccc2s1)[Cl])=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5928 |
| logD: | 3.5895 |
| logSw: | -4.3084 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.99 |
| InChI Key: | VNUXJOIGFDLSTB-JTQLQIEISA-N |