N~2~,N~5~-bis(4-phenylbutyl)pyridine-2,5-dicarboxamide
Chemical Structure Depiction of
N~2~,N~5~-bis(4-phenylbutyl)pyridine-2,5-dicarboxamide
N~2~,N~5~-bis(4-phenylbutyl)pyridine-2,5-dicarboxamide
Compound characteristics
| Compound ID: | Y200-1000 |
| Compound Name: | N~2~,N~5~-bis(4-phenylbutyl)pyridine-2,5-dicarboxamide |
| Molecular Weight: | 429.56 |
| Molecular Formula: | C27 H31 N3 O2 |
| Smiles: | C(CCNC(c1ccc(C(NCCCCc2ccccc2)=O)nc1)=O)Cc1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 5.0465 |
| logD: | 5.0465 |
| logSw: | -4.7838 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.886 |
| InChI Key: | BLUKOTSAFJFGPV-UHFFFAOYSA-N |