methyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(pyrazine-2-carbonyl)amino]thiophene-3-carboxylate
Chemical Structure Depiction of
methyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(pyrazine-2-carbonyl)amino]thiophene-3-carboxylate
methyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(pyrazine-2-carbonyl)amino]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y200-1019 |
| Compound Name: | methyl 5-[(4-chlorophenyl)carbamoyl]-4-methyl-2-[(pyrazine-2-carbonyl)amino]thiophene-3-carboxylate |
| Molecular Weight: | 430.87 |
| Molecular Formula: | C19 H15 Cl N4 O4 S |
| Smiles: | Cc1c(C(=O)OC)c(NC(c2cnccn2)=O)sc1C(Nc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 2.7485 |
| logD: | -2.1374 |
| logSw: | -3.8802 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 85.955 |
| InChI Key: | GDJWTDILONHADK-UHFFFAOYSA-N |