N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide
Chemical Structure Depiction of
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide
Compound characteristics
| Compound ID: | Y200-1314 |
| Compound Name: | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-phenylbutanamide |
| Molecular Weight: | 356.87 |
| Molecular Formula: | C19 H17 Cl N2 O S |
| Smiles: | CCC(C(Nc1nc(cs1)c1ccc(cc1)[Cl])=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1789 |
| logD: | 6.1786 |
| logSw: | -6.2726 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.104 |
| InChI Key: | XPBCDFDNYPRIDQ-MRXNPFEDSA-N |