2-(5-bromothiophen-2-yl)-6-methylquinoline-4-carboxylic acid
Chemical Structure Depiction of
2-(5-bromothiophen-2-yl)-6-methylquinoline-4-carboxylic acid
2-(5-bromothiophen-2-yl)-6-methylquinoline-4-carboxylic acid
Compound characteristics
| Compound ID: | Y200-1378 |
| Compound Name: | 2-(5-bromothiophen-2-yl)-6-methylquinoline-4-carboxylic acid |
| Molecular Weight: | 348.22 |
| Molecular Formula: | C15 H10 Br N O2 S |
| Smiles: | Cc1ccc2c(c1)c(cc(c1ccc(s1)[Br])n2)C(O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4573 |
| logD: | 1.3777 |
| logSw: | -5.3627 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.724 |
| InChI Key: | PLWOSTOUNYUDHX-UHFFFAOYSA-N |