propan-2-yl 4-(4-fluorophenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 4-(4-fluorophenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate
propan-2-yl 4-(4-fluorophenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate
Compound characteristics
| Compound ID: | Y200-2203 |
| Compound Name: | propan-2-yl 4-(4-fluorophenyl)-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate |
| Molecular Weight: | 387.43 |
| Molecular Formula: | C20 H18 F N O4 S |
| Smiles: | CC(C)OC(c1c(csc1NC(c1ccoc1C)=O)c1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6059 |
| logD: | 4.4685 |
| logSw: | -4.5383 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.518 |
| InChI Key: | QOZKTEDNFILITD-UHFFFAOYSA-N |