N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide
Compound characteristics
| Compound ID: | Y200-2241 |
| Compound Name: | N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| Molecular Weight: | 263.4 |
| Molecular Formula: | C15 H21 N O S |
| Smiles: | C1CCC(CC1)NC(c1csc2CCCCc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3362 |
| logD: | 4.3362 |
| logSw: | -4.2413 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.316 |
| InChI Key: | OYEZPHDTPBAARE-UHFFFAOYSA-N |