methyl 2-(4-aminophenyl)quinoline-4-carboxylate
Chemical Structure Depiction of
methyl 2-(4-aminophenyl)quinoline-4-carboxylate
methyl 2-(4-aminophenyl)quinoline-4-carboxylate
Compound characteristics
| Compound ID: | Y200-2526 |
| Compound Name: | methyl 2-(4-aminophenyl)quinoline-4-carboxylate |
| Molecular Weight: | 278.31 |
| Molecular Formula: | C17 H14 N2 O2 |
| Smiles: | COC(c1cc(c2ccc(cc2)N)nc2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4542 |
| logD: | 3.4533 |
| logSw: | -3.8392 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 50.277 |
| InChI Key: | SLJVLRVWOJQKEM-UHFFFAOYSA-N |