3-chloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide
Chemical Structure Depiction of
3-chloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide
3-chloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide
Compound characteristics
| Compound ID: | Y200-2796 |
| Compound Name: | 3-chloro-N-(3-ethylphenyl)-1-benzothiophene-2-carboxamide |
| Molecular Weight: | 315.82 |
| Molecular Formula: | C17 H14 Cl N O S |
| Smiles: | CCc1cccc(c1)NC(c1c(c2ccccc2s1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 5.4621 |
| logD: | 5.462 |
| logSw: | -5.9421 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 24.0764 |
| InChI Key: | JMRXETJEZANZBL-UHFFFAOYSA-N |