[2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl](piperidin-1-yl)methanone
					Chemical Structure Depiction of
[2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl](piperidin-1-yl)methanone
			[2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl](piperidin-1-yl)methanone
Compound characteristics
| Compound ID: | Y200-2997 | 
| Compound Name: | [2-(2,5-dimethylphenyl)-8-methylquinolin-4-yl](piperidin-1-yl)methanone | 
| Molecular Weight: | 358.48 | 
| Molecular Formula: | C24 H26 N2 O | 
| Smiles: | Cc1ccc(C)c(c1)c1cc(C(N2CCCCC2)=O)c2cccc(C)c2n1 | 
| Stereo: | ACHIRAL | 
| logP: | 5.904 | 
| logD: | 5.9032 | 
| logSw: | -5.579 | 
| Hydrogen bond acceptors count: | 3 | 
| Polar surface area: | 25.7163 | 
| InChI Key: | DQORCVTVSPCNDF-UHFFFAOYSA-N | 
 
				 
				